C14H24O2 — CID 102586581
(1S,2R,3R,7R,9R)-2,8-dimethyltricyclo[5.3.1.13,9]dodecane-2,8-diol (PubChem CID 102586581) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (1S,2R,3R,7R,9R)-2,8-dimethyltricyclo[5.3.1.13,9]dodecane-2,8-diol.
| Compound Name | (1S,2R,3R,7R,9R)-2,8-dimethyltricyclo[5.3.1.13,9]dodecane-2,8-diol |
|---|---|
| PubChem CID | 102586581 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (1S,2R,3R,7R,9R)-2,8-dimethyltricyclo[5.3.1.13,9]dodecane-2,8-diol |
| SMILES | CC1(O)[C@@H]2CCC[C@@H]3C[C@@H]1C[C@H](C2)[C@]3(C)O |
| InChI | InChI=1S/C14H24O2/c1-13(15)9-4-3-5-10-7-11(13)8-12(6-9)14(10,2)16/h9-12,15-16H,3-8H2,1-2H3/t9-,10-,11-,12+,13?,14-/m1/s1 |
| InChIKey | LDQQRAAOYUDLND-QFIBJEGBSA-N |
| XLogP | 2.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |