C8H14O2 — CID 130146915
7-methylbicyclo[2.2.1]heptane-2,7-diol (PubChem CID 130146915) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 7-methylbicyclo[2.2.1]heptane-2,7-diol.
| Compound Name | 7-methylbicyclo[2.2.1]heptane-2,7-diol |
|---|---|
| PubChem CID | 130146915 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 7-methylbicyclo[2.2.1]heptane-2,7-diol |
| SMILES | CC1(O)C2CCC1C(O)C2 |
| InChI | InChI=1S/C8H14O2/c1-8(10)5-2-3-6(8)7(9)4-5/h5-7,9-10H,2-4H2,1H3 |
| InChIKey | FGIVWKGBHIRTKE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |