C11H20O3 — CID 71385260
acetic acid;7,7-dimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 71385260) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is acetic acid;7,7-dimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | acetic acid;7,7-dimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 71385260 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | acetic acid;7,7-dimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC(=O)O.CC1(C)C2CCC1C(O)C2 |
| InChI | InChI=1S/C9H16O.C2H4O2/c1-9(2)6-3-4-7(9)8(10)5-6;1-2(3)4/h6-8,10H,3-5H2,1-2H3;1H3,(H,3,4) |
| InChIKey | QOBXAPLNEUYTCA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |