About (1S,2S,4S)-5,5-dimethylbicyclo[2.1.1]hexane-2-carboxylic acid
(1S,2S,4S)-5,5-dimethylbicyclo[2.1.1]hexane-2-carboxylic acid (PubChem CID 98513301) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is (1S,2S,4S)-5,5-dimethylbicyclo[2.1.1]hexane-2-carboxylic acid.
Analyze (1S,2S,4S)-5,5-dimethylbicyclo[2.1.1]hexane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S,4S)-5,5-dimethylbicyclo[2.1.1]hexane-2-carboxylic acid?
The IUPAC name of (1S,2S,4S)-5,5-dimethylbicyclo[2.1.1]hexane-2-carboxylic acid (CID 98513301) is (1S,2S,4S)-5,5-dimethylbicyclo[2.1.1]hexane-2-carboxylic acid.
What is the SMILES notation for (1S,2S,4S)-5,5-dimethylbicyclo[2.1.1]hexane-2-carboxylic acid?
The canonical SMILES for (1S,2S,4S)-5,5-dimethylbicyclo[2.1.1]hexane-2-carboxylic acid is CC1(C)[C@@H]2C[C@H](C(=O)O)[C@@H]1C2.
What is the InChIKey of (1S,2S,4S)-5,5-dimethylbicyclo[2.1.1]hexane-2-carboxylic acid?
The InChIKey is XTIVARKCKNUUEO-VQVTYTSYSA-N. The full InChI is InChI=1S/C9H14O2/c1-9(2)5-3-6(8(10)11)7(9)4-5/h5-7H,3-4H2,1-2H3,(H,10,11)/t5-,6+,7+/m1/s1.
What are the key properties of (1S,2S,4S)-5,5-dimethylbicyclo[2.1.1]hexane-2-carboxylic acid?
(1S,2S,4S)-5,5-dimethylbicyclo[2.1.1]hexane-2-carboxylic acid has a molecular weight of 154.21 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S,4S)-5,5-dimethylbicyclo[2.1.1]hexane-2-carboxylic acid is sourced from PubChem (CID 98513301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).