About potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate
potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate (PubChem CID 175847104) has the molecular formula C12H21KO2
and a molecular weight of 236.40 g/mol. Its IUPAC name is potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate.
Molecular Properties
| Compound Name | potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate |
| PubChem CID | 175847104 |
| Molecular Formula | C12H21KO2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate |
| SMILES | CC(=O)[O-].CC1CCC2CC1C2(C)C.[K+] |
| InChI | InChI=1S/C10H18.C2H4O2.K/c1-7-4-5-8-6-9(7)10(8,2)3;1-2(3)4;/h7-9H,4-6H2,1-3H3;1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | KUZKWUDTTDNXMG-UHFFFAOYSA-M |
| XLogP | -1.16 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate?
The IUPAC name of potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate (CID 175847104) is potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate.
What is the SMILES notation for potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate?
The canonical SMILES for potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate is CC(=O)[O-].CC1CCC2CC1C2(C)C.[K+].
What is the InChIKey of potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate?
The InChIKey is KUZKWUDTTDNXMG-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H18.C2H4O2.K/c1-7-4-5-8-6-9(7)10(8,2)3;1-2(3)4;/h7-9H,4-6H2,1-3H3;1H3,(H,3,4);/q;;+1/p-1.
What are the key properties of potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate?
potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate has a molecular weight of 236.40 g/mol, XLogP of -1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate is sourced from PubChem (CID 175847104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).