C12H21KO2 — CID 175847104
potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate (PubChem CID 175847104) has the molecular formula C12H21KO2 and a molecular weight of 236.40 g/mol. Its IUPAC name is potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate.
| Compound Name | potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate |
|---|---|
| PubChem CID | 175847104 |
| Molecular Formula | C12H21KO2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | potassium;2,6,6-trimethylbicyclo[3.1.1]heptane;acetate |
| SMILES | CC(=O)[O-].CC1CCC2CC1C2(C)C.[K+] |
| InChI | InChI=1S/C10H18.C2H4O2.K/c1-7-4-5-8-6-9(7)10(8,2)3;1-2(3)4;/h7-9H,4-6H2,1-3H3;1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | KUZKWUDTTDNXMG-UHFFFAOYSA-M |
| XLogP | -1.16 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |