C12H24 — CID 142979197
ethane;(1R,2R,5R)-2,6,6-trimethylbicyclo[3.1.1]heptane (PubChem CID 142979197) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is ethane;(1R,2R,5R)-2,6,6-trimethylbicyclo[3.1.1]heptane.
| Compound Name | ethane;(1R,2R,5R)-2,6,6-trimethylbicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 142979197 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | ethane;(1R,2R,5R)-2,6,6-trimethylbicyclo[3.1.1]heptane |
| SMILES | CC.C[C@@H]1CC[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C10H18.C2H6/c1-7-4-5-8-6-9(7)10(8,2)3;1-2/h7-9H,4-6H2,1-3H3;1-2H3/t7-,8-,9-;/m1./s1 |
| InChIKey | KFZUDZUKEKEBLP-AQLQUXDBSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |