C10H17Zn- — CID 134864548
(1R,2S,5R)-2-methanidyl-6,6-dimethylbicyclo[3.1.1]heptane;zinc (PubChem CID 134864548) has the molecular formula C10H17Zn- and a molecular weight of 202.64 g/mol. Its IUPAC name is (1R,2S,5R)-2-methanidyl-6,6-dimethylbicyclo[3.1.1]heptane;zinc.
| Compound Name | (1R,2S,5R)-2-methanidyl-6,6-dimethylbicyclo[3.1.1]heptane;zinc |
|---|---|
| PubChem CID | 134864548 |
| Molecular Formula | C10H17Zn- |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | (1R,2S,5R)-2-methanidyl-6,6-dimethylbicyclo[3.1.1]heptane;zinc |
| SMILES | [CH2-][C@H]1CC[C@@H]2C[C@H]1C2(C)C.[Zn] |
| InChI | InChI=1S/C10H17.Zn/c1-7-4-5-8-6-9(7)10(8,2)3;/h7-9H,1,4-6H2,2-3H3;/q-1;/t7-,8+,9+;/m0./s1 |
| InChIKey | NPWBFNVKUAWDNT-FZRXOQNUSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|