C20H34Zn — CID 19695024
zinc bis(2-methanidyl-6,6-dimethylbicyclo[3.1.1]heptane) (PubChem CID 19695024) has the molecular formula C20H34Zn and a molecular weight of 339.88 g/mol. Its IUPAC name is zinc bis(2-methanidyl-6,6-dimethylbicyclo[3.1.1]heptane).
| Compound Name | zinc bis(2-methanidyl-6,6-dimethylbicyclo[3.1.1]heptane) |
|---|---|
| PubChem CID | 19695024 |
| Molecular Formula | C20H34Zn |
| Molecular Weight | 339.88 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | zinc bis(2-methanidyl-6,6-dimethylbicyclo[3.1.1]heptane) |
| SMILES | [CH2-]C1CCC2CC1C2(C)C.[CH2-]C1CCC2CC1C2(C)C.[Zn+2] |
| InChI | InChI=1S/2C10H17.Zn/c2*1-7-4-5-8-6-9(7)10(8,2)3;/h2*7-9H,1,4-6H2,2-3H3;/q2*-1;+2 |
| InChIKey | GYNYTNQHDALRFQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.88 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|