C20H36O — CID 66964570
[(1S,3R,4R,8R,11S,12R)-4,12,15,15-tetramethyl-8-tricyclo[9.3.1.03,8]pentadecanyl]methanol (PubChem CID 66964570) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is [(1S,3R,4R,8R,11S,12R)-4,12,15,15-tetramethyl-8-tricyclo[9.3.1.03,8]pentadecanyl]methanol.
| Compound Name | [(1S,3R,4R,8R,11S,12R)-4,12,15,15-tetramethyl-8-tricyclo[9.3.1.03,8]pentadecanyl]methanol |
|---|---|
| PubChem CID | 66964570 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | [(1S,3R,4R,8R,11S,12R)-4,12,15,15-tetramethyl-8-tricyclo[9.3.1.03,8]pentadecanyl]methanol |
| SMILES | C[C@@H]1CCC[C@@]2(CO)CC[C@H]3[C@H](C)CC[C@@H](C[C@H]12)C3(C)C |
| InChI | InChI=1S/C20H36O/c1-14-6-5-10-20(13-21)11-9-17-15(2)7-8-16(12-18(14)20)19(17,3)4/h14-18,21H,5-13H2,1-4H3/t14-,15-,16+,17+,18-,20+/m1/s1 |
| InChIKey | LHTPCUAQKDKTEB-QFIAKTPHSA-N |
| XLogP | 5.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |