C26H50O2 — CID 68925708
1,1-diethoxyethane;(1S,3R,4R,8S,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadecane (PubChem CID 68925708) has the molecular formula C26H50O2 and a molecular weight of 394.68 g/mol. Its IUPAC name is 1,1-diethoxyethane;(1S,3R,4R,8S,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadecane.
| Compound Name | 1,1-diethoxyethane;(1S,3R,4R,8S,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadecane |
|---|---|
| PubChem CID | 68925708 |
| Molecular Formula | C26H50O2 |
| Molecular Weight | 394.68 g/mol |
| Exact Mass | 394.38 |
| IUPAC Name | 1,1-diethoxyethane;(1S,3R,4R,8S,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadecane |
| SMILES | CCOC(C)OCC.C[C@@H]1CCC[C@@]2(C)CC[C@H]3[C@H](C)CC[C@@H](C[C@H]12)C3(C)C |
| InChI | InChI=1S/C20H36.C6H14O2/c1-14-7-6-11-20(5)12-10-17-15(2)8-9-16(13-18(14)20)19(17,3)4;1-4-7-6(3)8-5-2/h14-18H,6-13H2,1-5H3;6H,4-5H2,1-3H3/t14-,15-,16+,17+,18-,20+;/m1./s1 |
| InChIKey | VHKDNPLMZLMVCH-GTHBOGNNSA-N |
| XLogP | 7.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.68 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|