C20H37NO5S — CID 87857014
nitroso hydrogen sulfate;(1S,3R,4R,8S,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadecane (PubChem CID 87857014) has the molecular formula C20H37NO5S and a molecular weight of 403.59 g/mol. Its IUPAC name is nitroso hydrogen sulfate;(1S,3R,4R,8S,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadecane.
| Compound Name | nitroso hydrogen sulfate;(1S,3R,4R,8S,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadecane |
|---|---|
| PubChem CID | 87857014 |
| Molecular Formula | C20H37NO5S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | nitroso hydrogen sulfate;(1S,3R,4R,8S,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadecane |
| SMILES | C[C@@H]1CCC[C@@]2(C)CC[C@H]3[C@H](C)CC[C@@H](C[C@H]12)C3(C)C.O=NOS(=O)(=O)O |
| InChI | InChI=1S/C20H36.HNO5S/c1-14-7-6-11-20(5)12-10-17-15(2)8-9-16(13-18(14)20)19(17,3)4;2-1-6-7(3,4)5/h14-18H,6-13H2,1-5H3;(H,3,4,5)/t14-,15-,16+,17+,18-,20+;/m1./s1 |
| InChIKey | HQCUFVFHAVGYBI-GTHBOGNNSA-N |
| XLogP | 5.79 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|