C20H36O2 — CID 66876307
[(1S,3R,4R,8S,11S,12R)-12-(hydroxymethyl)-8,15,15-trimethyl-4-tricyclo[9.3.1.03,8]pentadecanyl]methanol (PubChem CID 66876307) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is [(1S,3R,4R,8S,11S,12R)-12-(hydroxymethyl)-8,15,15-trimethyl-4-tricyclo[9.3.1.03,8]pentadecanyl]methanol.
| Compound Name | [(1S,3R,4R,8S,11S,12R)-12-(hydroxymethyl)-8,15,15-trimethyl-4-tricyclo[9.3.1.03,8]pentadecanyl]methanol |
|---|---|
| PubChem CID | 66876307 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | [(1S,3R,4R,8S,11S,12R)-12-(hydroxymethyl)-8,15,15-trimethyl-4-tricyclo[9.3.1.03,8]pentadecanyl]methanol |
| SMILES | CC1(C)[C@H]2CC[C@@H](CO)[C@@H]1CC[C@]1(C)CCC[C@@H](CO)[C@H]1C2 |
| InChI | InChI=1S/C20H36O2/c1-19(2)16-7-6-15(13-22)17(19)8-10-20(3)9-4-5-14(12-21)18(20)11-16/h14-18,21-22H,4-13H2,1-3H3/t14-,15-,16-,17-,18+,20-/m0/s1 |
| InChIKey | ZXROWHKYYNYHBO-IHEFFSNCSA-N |
| XLogP | 4.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |