About 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane
9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane (PubChem CID 121221251) has the molecular formula C11H21BO
and a molecular weight of 180.10 g/mol. Its IUPAC name is 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane.
Molecular Properties
| Compound Name | 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane |
| PubChem CID | 121221251 |
| Molecular Formula | C11H21BO |
| Molecular Weight | 180.10 g/mol |
| Exact Mass | 180.17 |
| IUPAC Name | 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane |
| SMILES | CC1(C)B(O)C2CCCC1CCC2 |
| InChI | InChI=1S/C11H21BO/c1-11(2)9-5-3-7-10(12(11)13)8-4-6-9/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | HPVJHUWHFZGZKG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.10 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane?
The IUPAC name of 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane (CID 121221251) is 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane.
What is the SMILES notation for 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane?
The canonical SMILES for 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane is CC1(C)B(O)C2CCCC1CCC2.
What is the InChIKey of 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane?
The InChIKey is HPVJHUWHFZGZKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21BO/c1-11(2)9-5-3-7-10(12(11)13)8-4-6-9/h9-10,13H,3-8H2,1-2H3.
What are the key properties of 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane?
9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane has a molecular weight of 180.10 g/mol, XLogP of 3.10, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane is sourced from PubChem (CID 121221251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).