C11H21BO — CID 121221251
9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane (PubChem CID 121221251) has the molecular formula C11H21BO and a molecular weight of 180.10 g/mol. Its IUPAC name is 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane.
| Compound Name | 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane |
|---|---|
| PubChem CID | 121221251 |
| Molecular Formula | C11H21BO |
| Molecular Weight | 180.10 g/mol |
| Exact Mass | 180.17 |
| IUPAC Name | 9-hydroxy-10,10-dimethyl-9-borabicyclo[3.3.2]decane |
| SMILES | CC1(C)B(O)C2CCCC1CCC2 |
| InChI | InChI=1S/C11H21BO/c1-11(2)9-5-3-7-10(12(11)13)8-4-6-9/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | HPVJHUWHFZGZKG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.10 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|