About tricyclo[5.4.0.08,11]undecane
tricyclo[5.4.0.08,11]undecane (PubChem CID 176586412) has the molecular formula C11H18
and a molecular weight of 150.26 g/mol. Its IUPAC name is tricyclo[5.4.0.08,11]undecane.
Molecular Properties
| Compound Name | tricyclo[5.4.0.08,11]undecane |
| PubChem CID | 176586412 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | tricyclo[5.4.0.08,11]undecane |
| SMILES | C1CCC2C(CC1)C1CCC21 |
| InChI | InChI=1S/C11H18/c1-2-4-8-9(5-3-1)11-7-6-10(8)11/h8-11H,1-7H2 |
| InChIKey | ZRDFDXRCYONCGI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tricyclo[5.4.0.08,11]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.4.0.08,11]undecane?
The IUPAC name of tricyclo[5.4.0.08,11]undecane (CID 176586412) is tricyclo[5.4.0.08,11]undecane.
What is the SMILES notation for tricyclo[5.4.0.08,11]undecane?
The canonical SMILES for tricyclo[5.4.0.08,11]undecane is C1CCC2C(CC1)C1CCC21.
What is the InChIKey of tricyclo[5.4.0.08,11]undecane?
The InChIKey is ZRDFDXRCYONCGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18/c1-2-4-8-9(5-3-1)11-7-6-10(8)11/h8-11H,1-7H2.
What are the key properties of tricyclo[5.4.0.08,11]undecane?
tricyclo[5.4.0.08,11]undecane has a molecular weight of 150.26 g/mol, XLogP of 3.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.4.0.08,11]undecane is sourced from PubChem (CID 176586412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).