C10H16S — CID 89269654
tricyclo[5.2.1.02,6]decane-10-thiol (PubChem CID 89269654) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is tricyclo[5.2.1.02,6]decane-10-thiol.
| Compound Name | tricyclo[5.2.1.02,6]decane-10-thiol |
|---|---|
| PubChem CID | 89269654 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | tricyclo[5.2.1.02,6]decane-10-thiol |
| SMILES | SC1C2CCC1C1CCCC21 |
| InChI | InChI=1S/C10H16S/c11-10-8-4-5-9(10)7-3-1-2-6(7)8/h6-11H,1-5H2 |
| InChIKey | AMJCFSWIPWBFEZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|