About tricyclo[5.2.1.02,6]decane-10-thiol
tricyclo[5.2.1.02,6]decane-10-thiol (PubChem CID 89269654) has the molecular formula C10H16S
and a molecular weight of 168.30 g/mol. Its IUPAC name is tricyclo[5.2.1.02,6]decane-10-thiol.
Molecular Properties
| Compound Name | tricyclo[5.2.1.02,6]decane-10-thiol |
| PubChem CID | 89269654 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | tricyclo[5.2.1.02,6]decane-10-thiol |
| SMILES | SC1C2CCC1C1CCCC21 |
| InChI | InChI=1S/C10H16S/c11-10-8-4-5-9(10)7-3-1-2-6(7)8/h6-11H,1-5H2 |
| InChIKey | AMJCFSWIPWBFEZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[5.2.1.02,6]decane-10-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.2.1.02,6]decane-10-thiol?
The IUPAC name of tricyclo[5.2.1.02,6]decane-10-thiol (CID 89269654) is tricyclo[5.2.1.02,6]decane-10-thiol.
What is the SMILES notation for tricyclo[5.2.1.02,6]decane-10-thiol?
The canonical SMILES for tricyclo[5.2.1.02,6]decane-10-thiol is SC1C2CCC1C1CCCC21.
What is the InChIKey of tricyclo[5.2.1.02,6]decane-10-thiol?
The InChIKey is AMJCFSWIPWBFEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S/c11-10-8-4-5-9(10)7-3-1-2-6(7)8/h6-11H,1-5H2.
What are the key properties of tricyclo[5.2.1.02,6]decane-10-thiol?
tricyclo[5.2.1.02,6]decane-10-thiol has a molecular weight of 168.30 g/mol, XLogP of 2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.2.1.02,6]decane-10-thiol is sourced from PubChem (CID 89269654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).