About CID 12639585
CID 12639585 (PubChem CID 12639585) has the molecular formula C18H33Si
and a molecular weight of 277.55 g/mol.
Molecular Properties
| Compound Name | CID 12639585 |
| PubChem CID | 12639585 |
| Molecular Formula | C18H33Si |
| Molecular Weight | 277.55 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | — |
| SMILES | C1CCC([Si](C2CCCCC2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H33Si/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h16-18H,1-15H2 |
| InChIKey | YKQPUNXIUGKUCS-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.55 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 12639585 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12639585?
The IUPAC name of CID 12639585 (CID 12639585) is not available.
What is the SMILES notation for CID 12639585?
The canonical SMILES for CID 12639585 is C1CCC([Si](C2CCCCC2)C2CCCCC2)CC1.
What is the InChIKey of CID 12639585?
The InChIKey is YKQPUNXIUGKUCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33Si/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h16-18H,1-15H2.
What are the key properties of CID 12639585?
CID 12639585 has a molecular weight of 277.55 g/mol, XLogP of 6.48, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12639585 is sourced from PubChem (CID 12639585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).