C11H18 — CID 101375325
(1S,2S,6R,7R)-tricyclo[5.4.0.02,6]undecane (PubChem CID 101375325) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is (1S,2S,6R,7R)-tricyclo[5.4.0.02,6]undecane.
| Compound Name | (1S,2S,6R,7R)-tricyclo[5.4.0.02,6]undecane |
|---|---|
| PubChem CID | 101375325 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (1S,2S,6R,7R)-tricyclo[5.4.0.02,6]undecane |
| SMILES | C1CC[C@H]2[C@@H](C1)[C@@H]1CCC[C@H]21 |
| InChI | InChI=1S/C11H18/c1-2-5-9-8(4-1)10-6-3-7-11(9)10/h8-11H,1-7H2/t8-,9+,10+,11- |
| InChIKey | AVMDXXIEGYYSAM-CKIJPRSSSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |