C20H32 — CID 101138772
pentacyclo[10.8.0.02,11.06,17.07,16]icosane (PubChem CID 101138772) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is pentacyclo[10.8.0.02,11.06,17.07,16]icosane.
| Compound Name | pentacyclo[10.8.0.02,11.06,17.07,16]icosane |
|---|---|
| PubChem CID | 101138772 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | pentacyclo[10.8.0.02,11.06,17.07,16]icosane |
| SMILES | C1CC2C3CCCC4C(C1)C1CCCC2C3CCCC41 |
| InChI | InChI=1S/C20H32/c1-5-13-15-7-2-8-16-14(6-1)18-10-3-9-17(13)19(15)11-4-12-20(16)18/h13-20H,1-12H2 |
| InChIKey | SHYUKFAMVXHXOH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |