C14H28 — CID 158606562
ethane;tricyclo[5.3.0.02,6]decane (PubChem CID 158606562) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is ethane;tricyclo[5.3.0.02,6]decane.
| Compound Name | ethane;tricyclo[5.3.0.02,6]decane |
|---|---|
| PubChem CID | 158606562 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | ethane;tricyclo[5.3.0.02,6]decane |
| SMILES | C1CC2C(C1)C1CCCC21.CC.CC |
| InChI | InChI=1S/C10H16.2C2H6/c1-3-7-8(4-1)10-6-2-5-9(7)10;2*1-2/h7-10H,1-6H2;2*1-2H3 |
| InChIKey | HWHMUHWYXCQASY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |