C12H24 — CID 158084419
7,8-dimethylbicyclo[4.2.0]octane;ethane (PubChem CID 158084419) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is 7,8-dimethylbicyclo[4.2.0]octane;ethane.
| Compound Name | 7,8-dimethylbicyclo[4.2.0]octane;ethane |
|---|---|
| PubChem CID | 158084419 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | 7,8-dimethylbicyclo[4.2.0]octane;ethane |
| SMILES | CC.CC1C(C)C2CCCCC12 |
| InChI | InChI=1S/C10H18.C2H6/c1-7-8(2)10-6-4-3-5-9(7)10;1-2/h7-10H,3-6H2,1-2H3;1-2H3 |
| InChIKey | FNIKUDLGMDXPIW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |