C19H34 — CID 91597819
ethane;pentacyclo[6.5.1.13,6.02,7.09,13]pentadecane (PubChem CID 91597819) has the molecular formula C19H34 and a molecular weight of 262.48 g/mol. Its IUPAC name is ethane;pentacyclo[6.5.1.13,6.02,7.09,13]pentadecane.
| Compound Name | ethane;pentacyclo[6.5.1.13,6.02,7.09,13]pentadecane |
|---|---|
| PubChem CID | 91597819 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | ethane;pentacyclo[6.5.1.13,6.02,7.09,13]pentadecane |
| SMILES | C1CC2C(C1)C1CC2C2C3CCC(C3)C12.CC.CC |
| InChI | InChI=1S/C15H22.2C2H6/c1-2-10-11(3-1)13-7-12(10)14-8-4-5-9(6-8)15(13)14;2*1-2/h8-15H,1-7H2;2*1-2H3 |
| InChIKey | OHIMGGBNDZKHEF-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|