About 4,6-dimethylpentacyclo[8.6.1.12,5.013,17.08,18]octadecane
4,6-dimethylpentacyclo[8.6.1.12,5.013,17.08,18]octadecane (PubChem CID 90872999) has the molecular formula C20H32
and a molecular weight of 272.48 g/mol. Its IUPAC name is 4,6-dimethylpentacyclo[8.6.1.12,5.013,17.08,18]octadecane.
Analyze 4,6-dimethylpentacyclo[8.6.1.12,5.013,17.08,18]octadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethylpentacyclo[8.6.1.12,5.013,17.08,18]octadecane?
The IUPAC name of 4,6-dimethylpentacyclo[8.6.1.12,5.013,17.08,18]octadecane (CID 90872999) is 4,6-dimethylpentacyclo[8.6.1.12,5.013,17.08,18]octadecane.
What is the SMILES notation for 4,6-dimethylpentacyclo[8.6.1.12,5.013,17.08,18]octadecane?
The canonical SMILES for 4,6-dimethylpentacyclo[8.6.1.12,5.013,17.08,18]octadecane is CC1CC2CC3CCC4CCCC(C5CC(C)C1C25)C43.
What is the InChIKey of 4,6-dimethylpentacyclo[8.6.1.12,5.013,17.08,18]octadecane?
The InChIKey is CSEQJKFGPINKCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32/c1-11-8-15-10-14-7-6-13-4-3-5-16(19(13)14)17-9-12(2)18(11)20(15)17/h11-20H,3-10H2,1-2H3.
What are the key properties of 4,6-dimethylpentacyclo[8.6.1.12,5.013,17.08,18]octadecane?
4,6-dimethylpentacyclo[8.6.1.12,5.013,17.08,18]octadecane has a molecular weight of 272.48 g/mol, XLogP of 5.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethylpentacyclo[8.6.1.12,5.013,17.08,18]octadecane is sourced from PubChem (CID 90872999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).