C12H18 — CID 146743747
tetracyclo[6.3.1.02,6.010,12]dodecane (PubChem CID 146743747) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is tetracyclo[6.3.1.02,6.010,12]dodecane.
| Compound Name | tetracyclo[6.3.1.02,6.010,12]dodecane |
|---|---|
| PubChem CID | 146743747 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | tetracyclo[6.3.1.02,6.010,12]dodecane |
| SMILES | C1CC2CC3CC4CC(C2C1)C34 |
| InChI | InChI=1S/C12H18/c1-2-7-4-8-5-9-6-11(12(8)9)10(7)3-1/h7-12H,1-6H2 |
| InChIKey | RLPBJSFCUKFBCI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |