C10H16 — CID 585864
tricyclo[4.4.0.02,8]decane (PubChem CID 585864) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is tricyclo[4.4.0.02,8]decane.
| Compound Name | tricyclo[4.4.0.02,8]decane |
|---|---|
| PubChem CID | 585864 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | tricyclo[4.4.0.02,8]decane |
| SMILES | C1CC2CC3CCC2C3C1 |
| InChI | InChI=1S/C10H16/c1-2-7-6-8-4-5-10(7)9(8)3-1/h7-10H,1-6H2 |
| InChIKey | TZGPAYCXWYKOMJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |