C19H32 — CID 123381567
tetracyclo[6.6.2.22,7.19,14]nonadecane (PubChem CID 123381567) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is tetracyclo[6.6.2.22,7.19,14]nonadecane.
| Compound Name | tetracyclo[6.6.2.22,7.19,14]nonadecane |
|---|---|
| PubChem CID | 123381567 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | tetracyclo[6.6.2.22,7.19,14]nonadecane |
| SMILES | C1CCC2CCC(C1)C1CCC2C2CCCCC1C2 |
| InChI | InChI=1S/C19H32/c1-2-6-15-10-9-14(5-1)18-11-12-19(15)17-8-4-3-7-16(18)13-17/h14-19H,1-13H2 |
| InChIKey | MVWHTXVMCCAAON-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|