C14H22 — CID 102370300
(1S,2R,6S,7R,8R,9R,10S,11S)-9,10-dimethyltetracyclo[5.4.1.02,6.08,11]dodecane (PubChem CID 102370300) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (1S,2R,6S,7R,8R,9R,10S,11S)-9,10-dimethyltetracyclo[5.4.1.02,6.08,11]dodecane.
| Compound Name | (1S,2R,6S,7R,8R,9R,10S,11S)-9,10-dimethyltetracyclo[5.4.1.02,6.08,11]dodecane |
|---|---|
| PubChem CID | 102370300 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (1S,2R,6S,7R,8R,9R,10S,11S)-9,10-dimethyltetracyclo[5.4.1.02,6.08,11]dodecane |
| SMILES | C[C@@H]1[C@H](C)[C@H]2[C@H]3C[C@H]([C@H]4CCC[C@H]43)[C@@H]12 |
| InChI | InChI=1S/C14H22/c1-7-8(2)14-12-6-11(13(7)14)9-4-3-5-10(9)12/h7-14H,3-6H2,1-2H3/t7-,8+,9+,10-,11-,12+,13-,14+ |
| InChIKey | RQVYTPRKJFIKLU-WBRCCVPBSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |