C14H22 — CID 59760764
10-methyltetracyclo[7.3.1.02,7.06,11]tridecane (PubChem CID 59760764) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 10-methyltetracyclo[7.3.1.02,7.06,11]tridecane.
| Compound Name | 10-methyltetracyclo[7.3.1.02,7.06,11]tridecane |
|---|---|
| PubChem CID | 59760764 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 10-methyltetracyclo[7.3.1.02,7.06,11]tridecane |
| SMILES | CC1C2CC3CC1C1CCCC3C1C2 |
| InChI | InChI=1S/C14H22/c1-8-9-5-10-7-13(8)12-4-2-3-11(10)14(12)6-9/h8-14H,2-7H2,1H3 |
| InChIKey | FEUOBIDLFQRQLA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |