C15H26 — CID 59883784
1,2,3-trimethyl-1,2,3,3a,4,4a,5,6,7,7a,8,8a-dodecahydro-s-indacene (PubChem CID 59883784) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 1,2,3-trimethyl-1,2,3,3a,4,4a,5,6,7,7a,8,8a-dodecahydro-s-indacene.
| Compound Name | 1,2,3-trimethyl-1,2,3,3a,4,4a,5,6,7,7a,8,8a-dodecahydro-s-indacene |
|---|---|
| PubChem CID | 59883784 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 1,2,3-trimethyl-1,2,3,3a,4,4a,5,6,7,7a,8,8a-dodecahydro-s-indacene |
| SMILES | CC1C(C)C2CC3CCCC3CC2C1C |
| InChI | InChI=1S/C15H26/c1-9-10(2)14-7-12-5-4-6-13(12)8-15(14)11(9)3/h9-15H,4-8H2,1-3H3 |
| InChIKey | KGXGPQFTNLJDMG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |