C14H32 — CID 162271460
ethane;methane;2-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 162271460) has the molecular formula C14H32 and a molecular weight of 200.41 g/mol. Its IUPAC name is ethane;methane;2-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | ethane;methane;2-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 162271460 |
| Molecular Formula | C14H32 |
| Molecular Weight | 200.41 g/mol |
| Exact Mass | 200.25 |
| IUPAC Name | ethane;methane;2-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | C.CC.CC.CC1CC2CCCC2C1 |
| InChI | InChI=1S/C9H16.2C2H6.CH4/c1-7-5-8-3-2-4-9(8)6-7;2*1-2;/h7-9H,2-6H2,1H3;2*1-2H3;1H4 |
| InChIKey | JEYZKKWSAQNWIX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.41 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |