C15H26 — CID 172615234
4-cyclopentyl-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 172615234) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 4-cyclopentyl-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 4-cyclopentyl-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 172615234 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 4-cyclopentyl-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CC1CC2CCCC(C3CCCC3)C2C1 |
| InChI | InChI=1S/C15H26/c1-11-9-13-7-4-8-14(15(13)10-11)12-5-2-3-6-12/h11-15H,2-10H2,1H3 |
| InChIKey | IXIPTNPDBBWGMP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |