C24H44 — CID 123237411
4-(3,5-ditert-butylcyclohexyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 123237411) has the molecular formula C24H44 and a molecular weight of 332.62 g/mol. Its IUPAC name is 4-(3,5-ditert-butylcyclohexyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 4-(3,5-ditert-butylcyclohexyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 123237411 |
| Molecular Formula | C24H44 |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 332.34 |
| IUPAC Name | 4-(3,5-ditert-butylcyclohexyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CC1CC2CCCC(C3CC(C(C)(C)C)CC(C(C)(C)C)C3)C2C1 |
| InChI | InChI=1S/C24H44/c1-16-11-17-9-8-10-21(22(17)12-16)18-13-19(23(2,3)4)15-20(14-18)24(5,6)7/h16-22H,8-15H2,1-7H3 |
| InChIKey | JIRCGSNAXSAMPR-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |