C20H36 — CID 143732334
ethane;3-methyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 143732334) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is ethane;3-methyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | ethane;3-methyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 143732334 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | ethane;3-methyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC.CC1CCC2C(CCC3C4CCCC4CCC23)C1 |
| InChI | InChI=1S/C18H30.C2H6/c1-12-5-8-16-14(11-12)7-10-17-15-4-2-3-13(15)6-9-18(16)17;1-2/h12-18H,2-11H2,1H3;1-2H3 |
| InChIKey | ANWRARHUGPPZFP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |