C18H32O — CID 155589363
ethene;(7-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthren-1-yl)methanol (PubChem CID 155589363) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is ethene;(7-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthren-1-yl)methanol.
| Compound Name | ethene;(7-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthren-1-yl)methanol |
|---|---|
| PubChem CID | 155589363 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | ethene;(7-methyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthren-1-yl)methanol |
| SMILES | C=C.CC1CCC2C(CCC3C(CO)CCCC32)C1 |
| InChI | InChI=1S/C16H28O.C2H4/c1-11-5-7-14-12(9-11)6-8-15-13(10-17)3-2-4-16(14)15;1-2/h11-17H,2-10H2,1H3;1-2H2 |
| InChIKey | NAPSIWHAOLMVQH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|