C22H36 — CID 155751511
(13R)-17-but-1-en-2-yl-3-methyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 155751511) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is (13R)-17-but-1-en-2-yl-3-methyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (13R)-17-but-1-en-2-yl-3-methyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 155751511 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | (13R)-17-but-1-en-2-yl-3-methyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C=C(CC)C1CCC2C3CCC4CC(C)CCC4C3CC[C@@H]12 |
| InChI | InChI=1S/C22H36/c1-4-15(3)17-9-10-22-19(17)11-12-20-18-7-5-14(2)13-16(18)6-8-21(20)22/h14,16-22H,3-13H2,1-2H3/t14?,16?,17?,18?,19-,20?,21?,22?/m0/s1 |
| InChIKey | BJXQXKBNLIQMPD-HHPQDGPKSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|