C13H20O2 — CID 166941479
ethyl (1S,6S,7R)-tricyclo[4.2.2.02,5]decane-7-carboxylate (PubChem CID 166941479) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is ethyl (1S,6S,7R)-tricyclo[4.2.2.02,5]decane-7-carboxylate.
| Compound Name | ethyl (1S,6S,7R)-tricyclo[4.2.2.02,5]decane-7-carboxylate |
|---|---|
| PubChem CID | 166941479 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | ethyl (1S,6S,7R)-tricyclo[4.2.2.02,5]decane-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]2CC[C@H]1C1CCC12 |
| InChI | InChI=1S/C13H20O2/c1-2-15-13(14)12-7-8-3-4-11(12)10-6-5-9(8)10/h8-12H,2-7H2,1H3/t8-,9?,10?,11-,12+/m0/s1 |
| InChIKey | WIXGTJMXYMWZPC-RFAQPDLFSA-N |
| XLogP | 2.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |