C10H17NO2 — CID 131850205
ethyl (3R,4S)-4-cyclopropylpyrrolidine-3-carboxylate (PubChem CID 131850205) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is ethyl (3R,4S)-4-cyclopropylpyrrolidine-3-carboxylate.
| Compound Name | ethyl (3R,4S)-4-cyclopropylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 131850205 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | ethyl (3R,4S)-4-cyclopropylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CNC[C@H]1C1CC1 |
| InChI | InChI=1S/C10H17NO2/c1-2-13-10(12)9-6-11-5-8(9)7-3-4-7/h7-9,11H,2-6H2,1H3/t8-,9-/m0/s1 |
| InChIKey | SXQBCFBECZNJCA-IUCAKERBSA-N |
| XLogP | 0.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |