C13H20O2 — CID 162434587
ethyl tricyclo[4.2.2.02,5]decane-7-carboxylate (PubChem CID 162434587) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is ethyl tricyclo[4.2.2.02,5]decane-7-carboxylate.
| Compound Name | ethyl tricyclo[4.2.2.02,5]decane-7-carboxylate |
|---|---|
| PubChem CID | 162434587 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | ethyl tricyclo[4.2.2.02,5]decane-7-carboxylate |
| SMILES | CCOC(=O)C1CC2CCC1C1CCC21 |
| InChI | InChI=1S/C13H20O2/c1-2-15-13(14)12-7-8-3-4-11(12)10-6-5-9(8)10/h8-12H,2-7H2,1H3 |
| InChIKey | WIXGTJMXYMWZPC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |