C30H44O4 — CID 158217531
bis(ethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate);tricyclo[5.2.1.02,6]decane (PubChem CID 158217531) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is bis(ethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate);tricyclo[5.2.1.02,6]decane.
| Compound Name | bis(ethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate);tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 158217531 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | bis(ethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate);tricyclo[5.2.1.02,6]decane |
| SMILES | C1CC2C3CCC(C3)C2C1.CCOC(=O)C1CC2C=CC1C2.CCOC(=O)C1CC2C=CC1C2 |
| InChI | InChI=1S/2C10H14O2.C10H16/c2*1-2-12-10(11)9-6-7-3-4-8(9)5-7;1-2-9-7-4-5-8(6-7)10(9)3-1/h2*3-4,7-9H,2,5-6H2,1H3;7-10H,1-6H2 |
| InChIKey | GCVOAAMNTREUEH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|