C14H24 — CID 71773994
2-methyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene (PubChem CID 71773994) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 2-methyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene.
| Compound Name | 2-methyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
|---|---|
| PubChem CID | 71773994 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 2-methyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
| SMILES | CC1CCC2C(C1)CC1CCCCC12 |
| InChI | InChI=1S/C14H24/c1-10-6-7-14-12(8-10)9-11-4-2-3-5-13(11)14/h10-14H,2-9H2,1H3 |
| InChIKey | KMAMHRTUDBGLPL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |