C12H22O2 — CID 11401364
[5-(hydroxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]methanol (PubChem CID 11401364) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is [5-(hydroxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]methanol.
| Compound Name | [5-(hydroxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 11401364 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | [5-(hydroxymethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]methanol |
| SMILES | OCC1CCC2C(CO)CCCC2C1 |
| InChI | InChI=1S/C12H22O2/c13-7-9-4-5-12-10(6-9)2-1-3-11(12)8-14/h9-14H,1-8H2 |
| InChIKey | HYPQZWQIWKPBLF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |