C11H20 — CID 14415240
5,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 14415240) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is 5,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 5,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 14415240 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 5,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CC1CC2CCCC2CC1C |
| InChI | InChI=1S/C11H20/c1-8-6-10-4-3-5-11(10)7-9(8)2/h8-11H,3-7H2,1-2H3 |
| InChIKey | PEFHUYJUIWCASP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |