About deuterium monohydride;1,2-dimethylcyclopropane
deuterium monohydride;1,2-dimethylcyclopropane (PubChem CID 159192336) has the molecular formula C5H12
and a molecular weight of 73.16 g/mol. Its IUPAC name is deuterium monohydride;1,2-dimethylcyclopropane.
Molecular Properties
| Compound Name | deuterium monohydride;1,2-dimethylcyclopropane |
| PubChem CID | 159192336 |
| Molecular Formula | C5H12 |
| Molecular Weight | 73.16 g/mol |
| Exact Mass | 73.10 |
| IUPAC Name | deuterium monohydride;1,2-dimethylcyclopropane |
| SMILES | CC1CC1C.[H][2H] |
| InChI | InChI=1S/C5H10.H2/c1-4-3-5(4)2;/h4-5H,3H2,1-2H3;1H/i;1+1 |
| InChIKey | KOFZEEUGXFINOF-IEOVAKBOSA-N |
| XLogP | 1.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 73.16 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze deuterium monohydride;1,2-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterium monohydride;1,2-dimethylcyclopropane?
The IUPAC name of deuterium monohydride;1,2-dimethylcyclopropane (CID 159192336) is deuterium monohydride;1,2-dimethylcyclopropane.
What is the SMILES notation for deuterium monohydride;1,2-dimethylcyclopropane?
The canonical SMILES for deuterium monohydride;1,2-dimethylcyclopropane is CC1CC1C.[H][2H].
What is the InChIKey of deuterium monohydride;1,2-dimethylcyclopropane?
The InChIKey is KOFZEEUGXFINOF-IEOVAKBOSA-N. The full InChI is InChI=1S/C5H10.H2/c1-4-3-5(4)2;/h4-5H,3H2,1-2H3;1H/i;1+1.
What are the key properties of deuterium monohydride;1,2-dimethylcyclopropane?
deuterium monohydride;1,2-dimethylcyclopropane has a molecular weight of 73.16 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for deuterium monohydride;1,2-dimethylcyclopropane is sourced from PubChem (CID 159192336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).