C10H17N — CID 11378594
(1S,2R,6R,7S)-tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 11378594) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (1S,2R,6R,7S)-tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | (1S,2R,6R,7S)-tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 11378594 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (1S,2R,6R,7S)-tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | NC1C[C@@H]2C[C@H]1[C@@H]1CCC[C@H]21 |
| InChI | InChI=1S/C10H17N/c11-10-5-6-4-9(10)8-3-1-2-7(6)8/h6-10H,1-5,11H2/t6-,7+,8+,9-,10?/m0/s1 |
| InChIKey | CRGOACNDJXEJHP-YHTCJBSDSA-N |
| XLogP | 1.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |