C8H15N — CID 124833630
(1R,6S,7R)-bicyclo[4.2.0]octan-7-amine (PubChem CID 124833630) has the molecular formula C8H15N and a molecular weight of 125.22 g/mol. Its IUPAC name is (1R,6S,7R)-bicyclo[4.2.0]octan-7-amine.
| Compound Name | (1R,6S,7R)-bicyclo[4.2.0]octan-7-amine |
|---|---|
| PubChem CID | 124833630 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.22 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (1R,6S,7R)-bicyclo[4.2.0]octan-7-amine |
| SMILES | N[C@@H]1C[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C8H15N/c9-8-5-6-3-1-2-4-7(6)8/h6-8H,1-5,9H2/t6-,7+,8-/m1/s1 |
| InChIKey | NTHUTVZYZXXSOR-GJMOJQLCSA-N |
| XLogP | 1.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |