C11H22N2 — CID 69411723
[1-(aminomethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]methanamine (PubChem CID 69411723) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is [1-(aminomethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]methanamine.
| Compound Name | [1-(aminomethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]methanamine |
|---|---|
| PubChem CID | 69411723 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | [1-(aminomethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]methanamine |
| SMILES | NCC1CC2CCCCC2C1CN |
| InChI | InChI=1S/C11H22N2/c12-6-9-5-8-3-1-2-4-10(8)11(9)7-13/h8-11H,1-7,12-13H2 |
| InChIKey | BAJRUKVVTRZIJA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |