C9H18ClN — CID 170922777
1,2,3,3a,4,5,6,6a-octahydropentalen-1-ylmethanamine;hydrochloride (PubChem CID 170922777) has the molecular formula C9H18ClN and a molecular weight of 175.70 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydropentalen-1-ylmethanamine;hydrochloride.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydropentalen-1-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 170922777 |
| Molecular Formula | C9H18ClN |
| Molecular Weight | 175.70 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydropentalen-1-ylmethanamine;hydrochloride |
| SMILES | Cl.NCC1CCC2CCCC12 |
| InChI | InChI=1S/C9H17N.ClH/c10-6-8-5-4-7-2-1-3-9(7)8;/h7-9H,1-6,10H2;1H |
| InChIKey | ZXVRFOOELGWSNU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.70 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |