C28H50 — CID 158442689
1,2,3,3a,4,5,6,7,8,9,10,10a-dodecahydrocyclopenta[9]annulene;1-(cyclohexylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 158442689) has the molecular formula C28H50 and a molecular weight of 386.71 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,7,8,9,10,10a-dodecahydrocyclopenta[9]annulene;1-(cyclohexylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 1,2,3,3a,4,5,6,7,8,9,10,10a-dodecahydrocyclopenta[9]annulene;1-(cyclohexylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 158442689 |
| Molecular Formula | C28H50 |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 386.39 |
| IUPAC Name | 1,2,3,3a,4,5,6,7,8,9,10,10a-dodecahydrocyclopenta[9]annulene;1-(cyclohexylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | C1CCC(CC2CCC3CCCCC32)CC1.C1CCCC2CCCC2CCC1 |
| InChI | InChI=1S/C16H28.C12H22/c1-2-6-13(7-3-1)12-15-11-10-14-8-4-5-9-16(14)15;1-2-4-7-11-9-6-10-12(11)8-5-3-1/h13-16H,1-12H2;11-12H,1-10H2 |
| InChIKey | HCZWIFJAQABGEC-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |