C15H32 — CID 143787282
1-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;methane;propane (PubChem CID 143787282) has the molecular formula C15H32 and a molecular weight of 212.42 g/mol. Its IUPAC name is 1-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;methane;propane.
| Compound Name | 1-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;methane;propane |
|---|---|
| PubChem CID | 143787282 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | 1-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;methane;propane |
| SMILES | C.CCC.CCC1CCC2CCCCC12 |
| InChI | InChI=1S/C11H20.C3H8.CH4/c1-2-9-7-8-10-5-3-4-6-11(9)10;1-3-2;/h9-11H,2-8H2,1H3;3H2,1-2H3;1H4 |
| InChIKey | YAUZHGNQQQNKCI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |