C14H25Cl — CID 70637827
2-butyl-1-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 70637827) has the molecular formula C14H25Cl and a molecular weight of 228.81 g/mol. Its IUPAC name is 2-butyl-1-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-butyl-1-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 70637827 |
| Molecular Formula | C14H25Cl |
| Molecular Weight | 228.81 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2-butyl-1-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCC1CCC2CCCCC2C1Cl |
| InChI | InChI=1S/C14H25Cl/c1-2-3-6-12-10-9-11-7-4-5-8-13(11)14(12)15/h11-14H,2-10H2,1H3 |
| InChIKey | PCIYJRIOZWBSMU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.81 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|