C22H40Zr+2 — CID 23230200
1-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;carbanide;zirconium(4+) (PubChem CID 23230200) has the molecular formula C22H40Zr+2 and a molecular weight of 395.79 g/mol. Its IUPAC name is 1-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;carbanide;zirconium(4+).
| Compound Name | 1-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;carbanide;zirconium(4+) |
|---|---|
| PubChem CID | 23230200 |
| Molecular Formula | C22H40Zr+2 |
| Molecular Weight | 395.79 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 1-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;carbanide;zirconium(4+) |
| SMILES | C1CCC2C(C1)CCC2CCC1CCC2CCCCC21.[CH3-].[CH3-].[Zr+4] |
| InChI | InChI=1S/C20H34.2CH3.Zr/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;;;/h15-20H,1-14H2;2*1H3;/q;2*-1;+4 |
| InChIKey | DAMWGSMYIQUVDY-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.79 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|